C22H23NO4S — CID 7638507
[(1R)-2-oxocyclohexyl] 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 7638507) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is [(1R)-2-oxocyclohexyl] 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | [(1R)-2-oxocyclohexyl] 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 7638507 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | [(1R)-2-oxocyclohexyl] 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | Cc1ccc(NC(=O)CSc2ccccc2C(=O)O[C@@H]2CCCCC2=O)cc1 |
| InChI | InChI=1S/C22H23NO4S/c1-15-10-12-16(13-11-15)23-21(25)14-28-20-9-5-2-6-17(20)22(26)27-19-8-4-3-7-18(19)24/h2,5-6,9-13,19H,3-4,7-8,14H2,1H3,(H,23,25)/t19-/m1/s1 |
| InChIKey | PCVVXPIUVIKVHA-LJQANCHMSA-N |
| XLogP | 4.39 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |