About 1-cyclopenta-1,3-dien-1-yl-3-(4-hydroxy-3-propan-2-ylphenyl)propan-1-one
1-cyclopenta-1,3-dien-1-yl-3-(4-hydroxy-3-propan-2-ylphenyl)propan-1-one (PubChem CID 159137719) has the molecular formula C17H20O2
and a molecular weight of 256.34 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-yl-3-(4-hydroxy-3-propan-2-ylphenyl)propan-1-one.
Molecular Properties
| Compound Name | 1-cyclopenta-1,3-dien-1-yl-3-(4-hydroxy-3-propan-2-ylphenyl)propan-1-one |
| PubChem CID | 159137719 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-yl-3-(4-hydroxy-3-propan-2-ylphenyl)propan-1-one |
| SMILES | CC(C)c1cc(CCC(=O)C2=CC=CC2)ccc1O |
| InChI | InChI=1S/C17H20O2/c1-12(2)15-11-13(8-10-17(15)19)7-9-16(18)14-5-3-4-6-14/h3-5,8,10-12,19H,6-7,9H2,1-2H3 |
| InChIKey | PWXQRKVFZJMUQR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopenta-1,3-dien-1-yl-3-(4-hydroxy-3-propan-2-ylphenyl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-1,3-dien-1-yl-3-(4-hydroxy-3-propan-2-ylphenyl)propan-1-one?
The IUPAC name of 1-cyclopenta-1,3-dien-1-yl-3-(4-hydroxy-3-propan-2-ylphenyl)propan-1-one (CID 159137719) is 1-cyclopenta-1,3-dien-1-yl-3-(4-hydroxy-3-propan-2-ylphenyl)propan-1-one.
What is the SMILES notation for 1-cyclopenta-1,3-dien-1-yl-3-(4-hydroxy-3-propan-2-ylphenyl)propan-1-one?
The canonical SMILES for 1-cyclopenta-1,3-dien-1-yl-3-(4-hydroxy-3-propan-2-ylphenyl)propan-1-one is CC(C)c1cc(CCC(=O)C2=CC=CC2)ccc1O.
What is the InChIKey of 1-cyclopenta-1,3-dien-1-yl-3-(4-hydroxy-3-propan-2-ylphenyl)propan-1-one?
The InChIKey is PWXQRKVFZJMUQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O2/c1-12(2)15-11-13(8-10-17(15)19)7-9-16(18)14-5-3-4-6-14/h3-5,8,10-12,19H,6-7,9H2,1-2H3.
What are the key properties of 1-cyclopenta-1,3-dien-1-yl-3-(4-hydroxy-3-propan-2-ylphenyl)propan-1-one?
1-cyclopenta-1,3-dien-1-yl-3-(4-hydroxy-3-propan-2-ylphenyl)propan-1-one has a molecular weight of 256.34 g/mol, XLogP of 3.90, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-1,3-dien-1-yl-3-(4-hydroxy-3-propan-2-ylphenyl)propan-1-one is sourced from PubChem (CID 159137719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).