C9H8O5 — CID 143286491
4-carboxyoxycyclohepta-1,3,5-triene-1-carboxylic acid (PubChem CID 143286491) has the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. Its IUPAC name is 4-carboxyoxycyclohepta-1,3,5-triene-1-carboxylic acid.
| Compound Name | 4-carboxyoxycyclohepta-1,3,5-triene-1-carboxylic acid |
|---|---|
| PubChem CID | 143286491 |
| Molecular Formula | C9H8O5 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 4-carboxyoxycyclohepta-1,3,5-triene-1-carboxylic acid |
| SMILES | O=C(O)OC1=CC=C(C(=O)O)CC=C1 |
| InChI | InChI=1S/C9H8O5/c10-8(11)6-2-1-3-7(5-4-6)14-9(12)13/h1,3-5H,2H2,(H,10,11)(H,12,13) |
| InChIKey | DJHIJNHZWCGYBR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |