C16H25NO — CID 144717942
4-ethyl-N,N-dipropylcyclohepta-1,3,5-triene-1-carboxamide (PubChem CID 144717942) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is 4-ethyl-N,N-dipropylcyclohepta-1,3,5-triene-1-carboxamide.
| Compound Name | 4-ethyl-N,N-dipropylcyclohepta-1,3,5-triene-1-carboxamide |
|---|---|
| PubChem CID | 144717942 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 4-ethyl-N,N-dipropylcyclohepta-1,3,5-triene-1-carboxamide |
| SMILES | CCCN(CCC)C(=O)C1=CC=C(CC)C=CC1 |
| InChI | InChI=1S/C16H25NO/c1-4-12-17(13-5-2)16(18)15-9-7-8-14(6-3)10-11-15/h7-8,10-11H,4-6,9,12-13H2,1-3H3 |
| InChIKey | HYIZVLPHQONFAB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |