C13H21NOS — CID 84556489
4,5-dimethyl-N,N-dipropylthiophene-3-carboxamide (PubChem CID 84556489) has the molecular formula C13H21NOS and a molecular weight of 239.38 g/mol. Its IUPAC name is 4,5-dimethyl-N,N-dipropylthiophene-3-carboxamide.
| Compound Name | 4,5-dimethyl-N,N-dipropylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 84556489 |
| Molecular Formula | C13H21NOS |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 4,5-dimethyl-N,N-dipropylthiophene-3-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1csc(C)c1C |
| InChI | InChI=1S/C13H21NOS/c1-5-7-14(8-6-2)13(15)12-9-16-11(4)10(12)3/h9H,5-8H2,1-4H3 |
| InChIKey | ANYBRGCWPMPJDH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |