About 2,6-dimethyl-N,N-dipropylpyridine-3-carboxamide
2,6-dimethyl-N,N-dipropylpyridine-3-carboxamide (PubChem CID 87024383) has the molecular formula C14H22N2O
and a molecular weight of 234.34 g/mol. Its IUPAC name is 2,6-dimethyl-N,N-dipropylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2,6-dimethyl-N,N-dipropylpyridine-3-carboxamide |
| PubChem CID | 87024383 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 2,6-dimethyl-N,N-dipropylpyridine-3-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(C)nc1C |
| InChI | InChI=1S/C14H22N2O/c1-5-9-16(10-6-2)14(17)13-8-7-11(3)15-12(13)4/h7-8H,5-6,9-10H2,1-4H3 |
| InChIKey | ZNBSESRPZAOBSR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-dimethyl-N,N-dipropylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-N,N-dipropylpyridine-3-carboxamide?
The IUPAC name of 2,6-dimethyl-N,N-dipropylpyridine-3-carboxamide (CID 87024383) is 2,6-dimethyl-N,N-dipropylpyridine-3-carboxamide.
What is the SMILES notation for 2,6-dimethyl-N,N-dipropylpyridine-3-carboxamide?
The canonical SMILES for 2,6-dimethyl-N,N-dipropylpyridine-3-carboxamide is CCCN(CCC)C(=O)c1ccc(C)nc1C.
What is the InChIKey of 2,6-dimethyl-N,N-dipropylpyridine-3-carboxamide?
The InChIKey is ZNBSESRPZAOBSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O/c1-5-9-16(10-6-2)14(17)13-8-7-11(3)15-12(13)4/h7-8H,5-6,9-10H2,1-4H3.
What are the key properties of 2,6-dimethyl-N,N-dipropylpyridine-3-carboxamide?
2,6-dimethyl-N,N-dipropylpyridine-3-carboxamide has a molecular weight of 234.34 g/mol, XLogP of 2.96, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-N,N-dipropylpyridine-3-carboxamide is sourced from PubChem (CID 87024383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).