C14H22N2O — CID 87011265
N-butyl-N-ethyl-2,6-dimethylpyridine-3-carboxamide (PubChem CID 87011265) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is N-butyl-N-ethyl-2,6-dimethylpyridine-3-carboxamide.
| Compound Name | N-butyl-N-ethyl-2,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 87011265 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | N-butyl-N-ethyl-2,6-dimethylpyridine-3-carboxamide |
| SMILES | CCCCN(CC)C(=O)c1ccc(C)nc1C |
| InChI | InChI=1S/C14H22N2O/c1-5-7-10-16(6-2)14(17)13-9-8-11(3)15-12(13)4/h8-9H,5-7,10H2,1-4H3 |
| InChIKey | HLUGVFJPUHVZPD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |