C11H16INOS — CID 78948915
5-iodo-N,N-dipropylthiophene-3-carboxamide (PubChem CID 78948915) has the molecular formula C11H16INOS and a molecular weight of 337.23 g/mol. Its IUPAC name is 5-iodo-N,N-dipropylthiophene-3-carboxamide.
| Compound Name | 5-iodo-N,N-dipropylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 78948915 |
| Molecular Formula | C11H16INOS |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | 5-iodo-N,N-dipropylthiophene-3-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1csc(I)c1 |
| InChI | InChI=1S/C11H16INOS/c1-3-5-13(6-4-2)11(14)9-7-10(12)15-8-9/h7-8H,3-6H2,1-2H3 |
| InChIKey | NCWVXANTVUMFNP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|