C10H11F3INOS — CID 78948563
5-iodo-N-propyl-N-(2,2,2-trifluoroethyl)thiophene-3-carboxamide (PubChem CID 78948563) has the molecular formula C10H11F3INOS and a molecular weight of 377.17 g/mol. Its IUPAC name is 5-iodo-N-propyl-N-(2,2,2-trifluoroethyl)thiophene-3-carboxamide.
| Compound Name | 5-iodo-N-propyl-N-(2,2,2-trifluoroethyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 78948563 |
| Molecular Formula | C10H11F3INOS |
| Molecular Weight | 377.17 g/mol |
| Exact Mass | 376.96 |
| IUPAC Name | 5-iodo-N-propyl-N-(2,2,2-trifluoroethyl)thiophene-3-carboxamide |
| SMILES | CCCN(CC(F)(F)F)C(=O)c1csc(I)c1 |
| InChI | InChI=1S/C10H11F3INOS/c1-2-3-15(6-10(11,12)13)9(16)7-4-8(14)17-5-7/h4-5H,2-3,6H2,1H3 |
| InChIKey | WCPMPPPYLUQOLC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.17 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|