C15H17IN2OS — CID 79685730
N-[(2-aminophenyl)methyl]-5-iodo-N-propylthiophene-3-carboxamide (PubChem CID 79685730) has the molecular formula C15H17IN2OS and a molecular weight of 400.29 g/mol. Its IUPAC name is N-[(2-aminophenyl)methyl]-5-iodo-N-propylthiophene-3-carboxamide.
| Compound Name | N-[(2-aminophenyl)methyl]-5-iodo-N-propylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 79685730 |
| Molecular Formula | C15H17IN2OS |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | N-[(2-aminophenyl)methyl]-5-iodo-N-propylthiophene-3-carboxamide |
| SMILES | CCCN(Cc1ccccc1N)C(=O)c1csc(I)c1 |
| InChI | InChI=1S/C15H17IN2OS/c1-2-7-18(9-11-5-3-4-6-13(11)17)15(19)12-8-14(16)20-10-12/h3-6,8,10H,2,7,9,17H2,1H3 |
| InChIKey | BEXLAKWLANTQLO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|