C11H16BrNOS — CID 55028228
3-bromo-N,N-dipropylthiophene-2-carboxamide (PubChem CID 55028228) has the molecular formula C11H16BrNOS and a molecular weight of 290.23 g/mol. Its IUPAC name is 3-bromo-N,N-dipropylthiophene-2-carboxamide.
| Compound Name | 3-bromo-N,N-dipropylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55028228 |
| Molecular Formula | C11H16BrNOS |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 3-bromo-N,N-dipropylthiophene-2-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1sccc1Br |
| InChI | InChI=1S/C11H16BrNOS/c1-3-6-13(7-4-2)11(14)10-9(12)5-8-15-10/h5,8H,3-4,6-7H2,1-2H3 |
| InChIKey | HMVTVUMUWCRLKS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |