C9H11BrN2O2S — CID 103102639
N-(2-amino-2-oxoethyl)-3-bromo-N-ethylthiophene-2-carboxamide (PubChem CID 103102639) has the molecular formula C9H11BrN2O2S and a molecular weight of 291.17 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3-bromo-N-ethylthiophene-2-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-3-bromo-N-ethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103102639 |
| Molecular Formula | C9H11BrN2O2S |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3-bromo-N-ethylthiophene-2-carboxamide |
| SMILES | CCN(CC(N)=O)C(=O)c1sccc1Br |
| InChI | InChI=1S/C9H11BrN2O2S/c1-2-12(5-7(11)13)9(14)8-6(10)3-4-15-8/h3-4H,2,5H2,1H3,(H2,11,13) |
| InChIKey | HJGTXCFWGZHVAB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |