C17H30N2O5 — CID 132897269
N,N-dibutyl-1-methyl-3,6-dihydro-2H-pyridine-5-carboxamide;oxalic acid (PubChem CID 132897269) has the molecular formula C17H30N2O5 and a molecular weight of 342.44 g/mol. Its IUPAC name is N,N-dibutyl-1-methyl-3,6-dihydro-2H-pyridine-5-carboxamide;oxalic acid.
| Compound Name | N,N-dibutyl-1-methyl-3,6-dihydro-2H-pyridine-5-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 132897269 |
| Molecular Formula | C17H30N2O5 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | N,N-dibutyl-1-methyl-3,6-dihydro-2H-pyridine-5-carboxamide;oxalic acid |
| SMILES | CCCCN(CCCC)C(=O)C1=CCCN(C)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H28N2O.C2H2O4/c1-4-6-11-17(12-7-5-2)15(18)14-9-8-10-16(3)13-14;3-1(4)2(5)6/h9H,4-8,10-13H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | FPQZPMSEQYPSQR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|