C10H13NO2 — CID 2229
prop-2-ynyl 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylate (PubChem CID 2229) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is prop-2-ynyl 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | prop-2-ynyl 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 2229 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | prop-2-ynyl 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylate |
| SMILES | C#CCOC(=O)C1=CCCN(C)C1 |
| InChI | InChI=1S/C10H13NO2/c1-3-7-13-10(12)9-5-4-6-11(2)8-9/h1,5H,4,6-8H2,2H3 |
| InChIKey | SPHRJZBOFYIKMC-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|