C17H30ClNO4 — CID 70414758
chloromethyl octanoate;methyl 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylate (PubChem CID 70414758) has the molecular formula C17H30ClNO4 and a molecular weight of 347.88 g/mol. Its IUPAC name is chloromethyl octanoate;methyl 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | chloromethyl octanoate;methyl 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 70414758 |
| Molecular Formula | C17H30ClNO4 |
| Molecular Weight | 347.88 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | chloromethyl octanoate;methyl 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylate |
| SMILES | CCCCCCCC(=O)OCCl.COC(=O)C1=CCCN(C)C1 |
| InChI | InChI=1S/C9H17ClO2.C8H13NO2/c1-2-3-4-5-6-7-9(11)12-8-10;1-9-5-3-4-7(6-9)8(10)11-2/h2-8H2,1H3;4H,3,5-6H2,1-2H3 |
| InChIKey | FKCKKVVOLWULLP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.88 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|