C15H20NO7Sb — CID 28362
methyl 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylate;4-stibonobenzoic acid (PubChem CID 28362) has the molecular formula C15H20NO7Sb and a molecular weight of 448.09 g/mol. Its IUPAC name is methyl 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylate;4-stibonobenzoic acid.
| Compound Name | methyl 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylate;4-stibonobenzoic acid |
|---|---|
| PubChem CID | 28362 |
| Molecular Formula | C15H20NO7Sb |
| Molecular Weight | 448.09 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | methyl 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylate;4-stibonobenzoic acid |
| SMILES | COC(=O)C1=CCCN(C)C1.O=C(O)c1ccc([Sb](=O)(O)O)cc1 |
| InChI | InChI=1S/C8H13NO2.C7H5O2.2H2O.O.Sb/c1-9-5-3-4-7(6-9)8(10)11-2;8-7(9)6-4-2-1-3-5-6;;;;/h4H,3,5-6H2,1-2H3;2-5H,(H,8,9);2*1H2;;/q;;;;;+2/p-2 |
| InChIKey | GRSQSUDXJNDWGN-UHFFFAOYSA-L |
| XLogP | -0.63 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.09 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|