C23H26ClNO3 — CID 139817242
methyl 1-[2-(2,2-diphenylethenoxy)ethyl]-3,6-dihydro-2H-pyridine-5-carboxylate;hydrochloride (PubChem CID 139817242) has the molecular formula C23H26ClNO3 and a molecular weight of 399.92 g/mol. Its IUPAC name is methyl 1-[2-(2,2-diphenylethenoxy)ethyl]-3,6-dihydro-2H-pyridine-5-carboxylate;hydrochloride.
| Compound Name | methyl 1-[2-(2,2-diphenylethenoxy)ethyl]-3,6-dihydro-2H-pyridine-5-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 139817242 |
| Molecular Formula | C23H26ClNO3 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | methyl 1-[2-(2,2-diphenylethenoxy)ethyl]-3,6-dihydro-2H-pyridine-5-carboxylate;hydrochloride |
| SMILES | COC(=O)C1=CCCN(CCOC=C(c2ccccc2)c2ccccc2)C1.Cl |
| InChI | InChI=1S/C23H25NO3.ClH/c1-26-23(25)21-13-8-14-24(17-21)15-16-27-18-22(19-9-4-2-5-10-19)20-11-6-3-7-12-20;/h2-7,9-13,18H,8,14-17H2,1H3;1H |
| InChIKey | VPAHAPULLXOTQV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|