C24H25Cl2NO3 — CID 70230365
methyl 1-[2-[(E)-2-(2,4-dichlorophenyl)-2-(2-methylphenyl)ethenoxy]ethyl]-3,6-dihydro-2H-pyridine-5-carboxylate (PubChem CID 70230365) has the molecular formula C24H25Cl2NO3 and a molecular weight of 446.37 g/mol. Its IUPAC name is methyl 1-[2-[(E)-2-(2,4-dichlorophenyl)-2-(2-methylphenyl)ethenoxy]ethyl]-3,6-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | methyl 1-[2-[(E)-2-(2,4-dichlorophenyl)-2-(2-methylphenyl)ethenoxy]ethyl]-3,6-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 70230365 |
| Molecular Formula | C24H25Cl2NO3 |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | methyl 1-[2-[(E)-2-(2,4-dichlorophenyl)-2-(2-methylphenyl)ethenoxy]ethyl]-3,6-dihydro-2H-pyridine-5-carboxylate |
| SMILES | COC(=O)C1=CCCN(CCO/C=C(\c2ccccc2C)c2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C24H25Cl2NO3/c1-17-6-3-4-8-20(17)22(21-10-9-19(25)14-23(21)26)16-30-13-12-27-11-5-7-18(15-27)24(28)29-2/h3-4,6-10,14,16H,5,11-13,15H2,1-2H3/b22-16+ |
| InChIKey | AIXHVCHCCRYPIX-CJLVFECKSA-N |
| XLogP | 5.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|