C25H28ClNO3 — CID 139787638
ethyl 1-[2-[2-(2-chlorophenyl)-2-(2-methylphenyl)ethenoxy]ethyl]-3,6-dihydro-2H-pyridine-5-carboxylate (PubChem CID 139787638) has the molecular formula C25H28ClNO3 and a molecular weight of 425.96 g/mol. Its IUPAC name is ethyl 1-[2-[2-(2-chlorophenyl)-2-(2-methylphenyl)ethenoxy]ethyl]-3,6-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | ethyl 1-[2-[2-(2-chlorophenyl)-2-(2-methylphenyl)ethenoxy]ethyl]-3,6-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 139787638 |
| Molecular Formula | C25H28ClNO3 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | ethyl 1-[2-[2-(2-chlorophenyl)-2-(2-methylphenyl)ethenoxy]ethyl]-3,6-dihydro-2H-pyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=CCCN(CCOC=C(c2ccccc2C)c2ccccc2Cl)C1 |
| InChI | InChI=1S/C25H28ClNO3/c1-3-30-25(28)20-10-8-14-27(17-20)15-16-29-18-23(21-11-5-4-9-19(21)2)22-12-6-7-13-24(22)26/h4-7,9-13,18H,3,8,14-17H2,1-2H3 |
| InChIKey | VQWYVKITRBXNEW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|