C37H44ClN3O7 — CID 45265672
1-[2-(benzhydrylideneamino)oxyethyl]-3,6-dihydro-2H-pyridine-5-carboxylic acid;methyl (Z)-4-[(2-methoxy-2-oxoethyl)-methylamino]-3-phenylpent-2-enoate;hydrochloride (PubChem CID 45265672) has the molecular formula C37H44ClN3O7 and a molecular weight of 678.23 g/mol. Its IUPAC name is 1-[2-(benzhydrylideneamino)oxyethyl]-3,6-dihydro-2H-pyridine-5-carboxylic acid;methyl (Z)-4-[(2-methoxy-2-oxoethyl)-methylamino]-3-phenylpent-2-enoate;hydrochloride.
| Compound Name | 1-[2-(benzhydrylideneamino)oxyethyl]-3,6-dihydro-2H-pyridine-5-carboxylic acid;methyl (Z)-4-[(2-methoxy-2-oxoethyl)-methylamino]-3-phenylpent-2-enoate;hydrochloride |
|---|---|
| PubChem CID | 45265672 |
| Molecular Formula | C37H44ClN3O7 |
| Molecular Weight | 678.23 g/mol |
| Exact Mass | 677.29 |
| IUPAC Name | 1-[2-(benzhydrylideneamino)oxyethyl]-3,6-dihydro-2H-pyridine-5-carboxylic acid;methyl (Z)-4-[(2-methoxy-2-oxoethyl)-methylamino]-3-phenylpent-2-enoate;hydrochloride |
| SMILES | COC(=O)/C=C(/c1ccccc1)C(C)N(C)CC(=O)OC.Cl.O=C(O)C1=CCCN(CCON=C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C21H22N2O3.C16H21NO4.ClH/c24-21(25)19-12-7-13-23(16-19)14-15-26-22-20(17-8-3-1-4-9-17)18-10-5-2-6-11-18;1-12(17(2)11-16(19)21-4)14(10-15(18)20-3)13-8-6-5-7-9-13;/h1-6,8-12H,7,13-16H2,(H,24,25);5-10,12H,11H2,1-4H3;1H/b;14-10+; |
| InChIKey | NLSWVOSASINWAY-HWVPHXJSSA-N |
| XLogP | 5.33 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.23 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenone(7)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|