C21H24NO3P — CID 142006751
1-(2-benzhydrylphosphanyloxyethyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid (PubChem CID 142006751) has the molecular formula C21H24NO3P and a molecular weight of 369.40 g/mol. Its IUPAC name is 1-(2-benzhydrylphosphanyloxyethyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid.
| Compound Name | 1-(2-benzhydrylphosphanyloxyethyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 142006751 |
| Molecular Formula | C21H24NO3P |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 1-(2-benzhydrylphosphanyloxyethyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid |
| SMILES | O=C(O)C1=CCCN(CCOPC(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C21H24NO3P/c23-21(24)19-12-7-13-22(16-19)14-15-25-26-20(17-8-3-1-4-9-17)18-10-5-2-6-11-18/h1-6,8-12,20,26H,7,13-16H2,(H,23,24) |
| InChIKey | QLTYRJNOMJAWNR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|