About 1-cyclohexa-1,3-dien-1-ylethanone;N-methylmethanamine
1-cyclohexa-1,3-dien-1-ylethanone;N-methylmethanamine (PubChem CID 143915057) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-ylethanone;N-methylmethanamine.
Analyze 1-cyclohexa-1,3-dien-1-ylethanone;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,3-dien-1-ylethanone;N-methylmethanamine?
The IUPAC name of 1-cyclohexa-1,3-dien-1-ylethanone;N-methylmethanamine (CID 143915057) is 1-cyclohexa-1,3-dien-1-ylethanone;N-methylmethanamine.
What is the SMILES notation for 1-cyclohexa-1,3-dien-1-ylethanone;N-methylmethanamine?
The canonical SMILES for 1-cyclohexa-1,3-dien-1-ylethanone;N-methylmethanamine is CC(=O)C1=CC=CCC1.CNC.
What is the InChIKey of 1-cyclohexa-1,3-dien-1-ylethanone;N-methylmethanamine?
The InChIKey is NAFFKBPUQKLFPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.C2H7N/c1-7(9)8-5-3-2-4-6-8;1-3-2/h2-3,5H,4,6H2,1H3;3H,1-2H3.
What are the key properties of 1-cyclohexa-1,3-dien-1-ylethanone;N-methylmethanamine?
1-cyclohexa-1,3-dien-1-ylethanone;N-methylmethanamine has a molecular weight of 167.25 g/mol, XLogP of 1.69, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,3-dien-1-ylethanone;N-methylmethanamine is sourced from PubChem (CID 143915057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).