C10H14O — CID 91374956
1-(5-methylcyclohepta-1,3-dien-1-yl)ethanone (PubChem CID 91374956) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 1-(5-methylcyclohepta-1,3-dien-1-yl)ethanone.
| Compound Name | 1-(5-methylcyclohepta-1,3-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 91374956 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 1-(5-methylcyclohepta-1,3-dien-1-yl)ethanone |
| SMILES | CC(=O)C1=CC=CC(C)CC1 |
| InChI | InChI=1S/C10H14O/c1-8-4-3-5-10(7-6-8)9(2)11/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | FHNQHCMTKBYJGG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |