C16H26N2O3 — CID 143726792
N'-hydroxy-N-(5-methylcyclohepta-1,3-dien-1-yl)octanediamide (PubChem CID 143726792) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is N'-hydroxy-N-(5-methylcyclohepta-1,3-dien-1-yl)octanediamide.
| Compound Name | N'-hydroxy-N-(5-methylcyclohepta-1,3-dien-1-yl)octanediamide |
|---|---|
| PubChem CID | 143726792 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | N'-hydroxy-N-(5-methylcyclohepta-1,3-dien-1-yl)octanediamide |
| SMILES | CC1C=CC=C(NC(=O)CCCCCCC(=O)NO)CC1 |
| InChI | InChI=1S/C16H26N2O3/c1-13-7-6-8-14(12-11-13)17-15(19)9-4-2-3-5-10-16(20)18-21/h6-8,13,21H,2-5,9-12H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | OIRXFTKHBNJAMJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|