About N-cyclopenta-1,3-dien-1-yl-3-phosphanylpropanamide
N-cyclopenta-1,3-dien-1-yl-3-phosphanylpropanamide (PubChem CID 58065573) has the molecular formula C8H12NOP
and a molecular weight of 169.16 g/mol. Its IUPAC name is N-cyclopenta-1,3-dien-1-yl-3-phosphanylpropanamide.
Molecular Properties
| Compound Name | N-cyclopenta-1,3-dien-1-yl-3-phosphanylpropanamide |
| PubChem CID | 58065573 |
| Molecular Formula | C8H12NOP |
| Molecular Weight | 169.16 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | N-cyclopenta-1,3-dien-1-yl-3-phosphanylpropanamide |
| SMILES | O=C(CCP)NC1=CC=CC1 |
| InChI | InChI=1S/C8H12NOP/c10-8(5-6-11)9-7-3-1-2-4-7/h1-3H,4-6,11H2,(H,9,10) |
| InChIKey | ZOGNAUNLRJRUAJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.16 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopenta-1,3-dien-1-yl-3-phosphanylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopenta-1,3-dien-1-yl-3-phosphanylpropanamide?
The IUPAC name of N-cyclopenta-1,3-dien-1-yl-3-phosphanylpropanamide (CID 58065573) is N-cyclopenta-1,3-dien-1-yl-3-phosphanylpropanamide.
What is the SMILES notation for N-cyclopenta-1,3-dien-1-yl-3-phosphanylpropanamide?
The canonical SMILES for N-cyclopenta-1,3-dien-1-yl-3-phosphanylpropanamide is O=C(CCP)NC1=CC=CC1.
What is the InChIKey of N-cyclopenta-1,3-dien-1-yl-3-phosphanylpropanamide?
The InChIKey is ZOGNAUNLRJRUAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12NOP/c10-8(5-6-11)9-7-3-1-2-4-7/h1-3H,4-6,11H2,(H,9,10).
What are the key properties of N-cyclopenta-1,3-dien-1-yl-3-phosphanylpropanamide?
N-cyclopenta-1,3-dien-1-yl-3-phosphanylpropanamide has a molecular weight of 169.16 g/mol, XLogP of 1.21, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopenta-1,3-dien-1-yl-3-phosphanylpropanamide is sourced from PubChem (CID 58065573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).