C17H26ClN3O3 — CID 89400497
N-[4-[(1S,2R)-2-aminocyclopropyl]phenyl]-N'-hydroxyoctanediamide;hydrochloride (PubChem CID 89400497) has the molecular formula C17H26ClN3O3 and a molecular weight of 355.87 g/mol. Its IUPAC name is N-[4-[(1S,2R)-2-aminocyclopropyl]phenyl]-N'-hydroxyoctanediamide;hydrochloride.
| Compound Name | N-[4-[(1S,2R)-2-aminocyclopropyl]phenyl]-N'-hydroxyoctanediamide;hydrochloride |
|---|---|
| PubChem CID | 89400497 |
| Molecular Formula | C17H26ClN3O3 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | N-[4-[(1S,2R)-2-aminocyclopropyl]phenyl]-N'-hydroxyoctanediamide;hydrochloride |
| SMILES | Cl.N[C@@H]1C[C@H]1c1ccc(NC(=O)CCCCCCC(=O)NO)cc1 |
| InChI | InChI=1S/C17H25N3O3.ClH/c18-15-11-14(15)12-7-9-13(10-8-12)19-16(21)5-3-1-2-4-6-17(22)20-23;/h7-10,14-15,23H,1-6,11,18H2,(H,19,21)(H,20,22);1H/t14-,15+;/m0./s1 |
| InChIKey | DKTJJGDDWKTNKJ-LDXVYITESA-N |
| XLogP | 2.71 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|