C38H58N8O6 — CID 177374283
N-[4-[3-[4-[3-[[4-[4-(2-aminocyclopropyl)anilino]-4-oxobutanoyl]amino]propylamino]butylamino]propylcarbamoyl]phenyl]-N'-hydroxyoctanediamide (PubChem CID 177374283) has the molecular formula C38H58N8O6 and a molecular weight of 722.93 g/mol. Its IUPAC name is N-[4-[3-[4-[3-[[4-[4-(2-aminocyclopropyl)anilino]-4-oxobutanoyl]amino]propylamino]butylamino]propylcarbamoyl]phenyl]-N'-hydroxyoctanediamide.
| Compound Name | N-[4-[3-[4-[3-[[4-[4-(2-aminocyclopropyl)anilino]-4-oxobutanoyl]amino]propylamino]butylamino]propylcarbamoyl]phenyl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 177374283 |
| Molecular Formula | C38H58N8O6 |
| Molecular Weight | 722.93 g/mol |
| Exact Mass | 722.45 |
| IUPAC Name | N-[4-[3-[4-[3-[[4-[4-(2-aminocyclopropyl)anilino]-4-oxobutanoyl]amino]propylamino]butylamino]propylcarbamoyl]phenyl]-N'-hydroxyoctanediamide |
| SMILES | NC1CC1c1ccc(NC(=O)CCC(=O)NCCCNCCCCNCCCNC(=O)c2ccc(NC(=O)CCCCCCC(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C38H58N8O6/c39-33-27-32(33)28-11-15-30(16-12-28)45-36(49)20-19-34(47)42-25-7-23-40-21-5-6-22-41-24-8-26-43-38(51)29-13-17-31(18-14-29)44-35(48)9-3-1-2-4-10-37(50)46-52/h11-18,32-33,40-41,52H,1-10,19-27,39H2,(H,42,47)(H,43,51)(H,44,48)(H,45,49)(H,46,50) |
| InChIKey | FOOLAZWZXXARID-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 215.81 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.93 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|