About N-[4-(2-aminocyclopropyl)phenyl]-N'-hydroxyoctanediamide
N-[4-(2-aminocyclopropyl)phenyl]-N'-hydroxyoctanediamide (PubChem CID 86676519) has the molecular formula C17H25N3O3
and a molecular weight of 319.41 g/mol. Its IUPAC name is N-[4-(2-aminocyclopropyl)phenyl]-N'-hydroxyoctanediamide.
Molecular Properties
| Compound Name | N-[4-(2-aminocyclopropyl)phenyl]-N'-hydroxyoctanediamide |
| PubChem CID | 86676519 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | N-[4-(2-aminocyclopropyl)phenyl]-N'-hydroxyoctanediamide |
| SMILES | NC1CC1c1ccc(NC(=O)CCCCCCC(=O)NO)cc1 |
| InChI | InChI=1S/C17H25N3O3/c18-15-11-14(15)12-7-9-13(10-8-12)19-16(21)5-3-1-2-4-6-17(22)20-23/h7-10,14-15,23H,1-6,11,18H2,(H,19,21)(H,20,22) |
| InChIKey | RHUFUBPIUVMUHP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(2-aminocyclopropyl)phenyl]-N'-hydroxyoctanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2-aminocyclopropyl)phenyl]-N'-hydroxyoctanediamide?
The IUPAC name of N-[4-(2-aminocyclopropyl)phenyl]-N'-hydroxyoctanediamide (CID 86676519) is N-[4-(2-aminocyclopropyl)phenyl]-N'-hydroxyoctanediamide.
What is the SMILES notation for N-[4-(2-aminocyclopropyl)phenyl]-N'-hydroxyoctanediamide?
The canonical SMILES for N-[4-(2-aminocyclopropyl)phenyl]-N'-hydroxyoctanediamide is NC1CC1c1ccc(NC(=O)CCCCCCC(=O)NO)cc1.
What is the InChIKey of N-[4-(2-aminocyclopropyl)phenyl]-N'-hydroxyoctanediamide?
The InChIKey is RHUFUBPIUVMUHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N3O3/c18-15-11-14(15)12-7-9-13(10-8-12)19-16(21)5-3-1-2-4-6-17(22)20-23/h7-10,14-15,23H,1-6,11,18H2,(H,19,21)(H,20,22).
What are the key properties of N-[4-(2-aminocyclopropyl)phenyl]-N'-hydroxyoctanediamide?
N-[4-(2-aminocyclopropyl)phenyl]-N'-hydroxyoctanediamide has a molecular weight of 319.41 g/mol, XLogP of 2.29, 9 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2-aminocyclopropyl)phenyl]-N'-hydroxyoctanediamide is sourced from PubChem (CID 86676519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).