C16H20N2O7 — CID 50916877
4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phthalic acid (PubChem CID 50916877) has the molecular formula C16H20N2O7 and a molecular weight of 352.34 g/mol. Its IUPAC name is 4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phthalic acid.
| Compound Name | 4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phthalic acid |
|---|---|
| PubChem CID | 50916877 |
| Molecular Formula | C16H20N2O7 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phthalic acid |
| SMILES | O=C(CCCCCCC(=O)Nc1ccc(C(=O)O)c(C(=O)O)c1)NO |
| InChI | InChI=1S/C16H20N2O7/c19-13(5-3-1-2-4-6-14(20)18-25)17-10-7-8-11(15(21)22)12(9-10)16(23)24/h7-9,25H,1-6H2,(H,17,19)(H,18,20)(H,21,22)(H,23,24) |
| InChIKey | CZXXAPKWOKUZJW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|