C24H30N4O4 — CID 118362902
N'-[4-[4-[4-(2-aminocyclopropyl)anilino]-4-oxobutyl]phenyl]-N-hydroxy-2-methylbutanediamide (PubChem CID 118362902) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is N'-[4-[4-[4-(2-aminocyclopropyl)anilino]-4-oxobutyl]phenyl]-N-hydroxy-2-methylbutanediamide.
| Compound Name | N'-[4-[4-[4-(2-aminocyclopropyl)anilino]-4-oxobutyl]phenyl]-N-hydroxy-2-methylbutanediamide |
|---|---|
| PubChem CID | 118362902 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | N'-[4-[4-[4-(2-aminocyclopropyl)anilino]-4-oxobutyl]phenyl]-N-hydroxy-2-methylbutanediamide |
| SMILES | CC(CC(=O)Nc1ccc(CCCC(=O)Nc2ccc(C3CC3N)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C24H30N4O4/c1-15(24(31)28-32)13-23(30)27-18-9-5-16(6-10-18)3-2-4-22(29)26-19-11-7-17(8-12-19)20-14-21(20)25/h5-12,15,20-21,32H,2-4,13-14,25H2,1H3,(H,26,29)(H,27,30)(H,28,31) |
| InChIKey | MIUIEJRDDRHQDE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|