C27H30N4O2 — CID 159868065
4-[4-[4-[2-(aminomethyl)cyclopropyl]anilino]-4-oxobutyl]-N-(2-aminophenyl)benzamide (PubChem CID 159868065) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 4-[4-[4-[2-(aminomethyl)cyclopropyl]anilino]-4-oxobutyl]-N-(2-aminophenyl)benzamide.
| Compound Name | 4-[4-[4-[2-(aminomethyl)cyclopropyl]anilino]-4-oxobutyl]-N-(2-aminophenyl)benzamide |
|---|---|
| PubChem CID | 159868065 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 4-[4-[4-[2-(aminomethyl)cyclopropyl]anilino]-4-oxobutyl]-N-(2-aminophenyl)benzamide |
| SMILES | NCC1CC1c1ccc(NC(=O)CCCc2ccc(C(=O)Nc3ccccc3N)cc2)cc1 |
| InChI | InChI=1S/C27H30N4O2/c28-17-21-16-23(21)19-12-14-22(15-13-19)30-26(32)7-3-4-18-8-10-20(11-9-18)27(33)31-25-6-2-1-5-24(25)29/h1-2,5-6,8-15,21,23H,3-4,7,16-17,28-29H2,(H,30,32)(H,31,33) |
| InChIKey | KOBSWPYUFIEVIH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|