C26H28N4O3 — CID 134533298
N'-[4-[2-(2-aminoanilino)-2-oxoethyl]phenyl]-N-phenylhexanediamide (PubChem CID 134533298) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is N'-[4-[2-(2-aminoanilino)-2-oxoethyl]phenyl]-N-phenylhexanediamide.
| Compound Name | N'-[4-[2-(2-aminoanilino)-2-oxoethyl]phenyl]-N-phenylhexanediamide |
|---|---|
| PubChem CID | 134533298 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N'-[4-[2-(2-aminoanilino)-2-oxoethyl]phenyl]-N-phenylhexanediamide |
| SMILES | Nc1ccccc1NC(=O)Cc1ccc(NC(=O)CCCCC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C26H28N4O3/c27-22-10-4-5-11-23(22)30-26(33)18-19-14-16-21(17-15-19)29-25(32)13-7-6-12-24(31)28-20-8-2-1-3-9-20/h1-5,8-11,14-17H,6-7,12-13,18,27H2,(H,28,31)(H,29,32)(H,30,33) |
| InChIKey | PSPIPCINGGQRBL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|