C36H47N3O5 — CID 159516285
N-(2-aminophenyl)-8-(4-methylphenyl)-8-oxooctanamide;9-hydroxy-8-oxo-N-phenylnonanamide (PubChem CID 159516285) has the molecular formula C36H47N3O5 and a molecular weight of 601.79 g/mol. Its IUPAC name is N-(2-aminophenyl)-8-(4-methylphenyl)-8-oxooctanamide;9-hydroxy-8-oxo-N-phenylnonanamide.
| Compound Name | N-(2-aminophenyl)-8-(4-methylphenyl)-8-oxooctanamide;9-hydroxy-8-oxo-N-phenylnonanamide |
|---|---|
| PubChem CID | 159516285 |
| Molecular Formula | C36H47N3O5 |
| Molecular Weight | 601.79 g/mol |
| Exact Mass | 601.35 |
| IUPAC Name | N-(2-aminophenyl)-8-(4-methylphenyl)-8-oxooctanamide;9-hydroxy-8-oxo-N-phenylnonanamide |
| SMILES | Cc1ccc(C(=O)CCCCCCC(=O)Nc2ccccc2N)cc1.O=C(CO)CCCCCCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H26N2O2.C15H21NO3/c1-16-12-14-17(15-13-16)20(24)10-4-2-3-5-11-21(25)23-19-9-7-6-8-18(19)22;17-12-14(18)10-6-1-2-7-11-15(19)16-13-8-4-3-5-9-13/h6-9,12-15H,2-5,10-11,22H2,1H3,(H,23,25);3-5,8-9,17H,1-2,6-7,10-12H2,(H,16,19) |
| InChIKey | MBFVBHYUMQHVIP-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.79 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|