C31H37N3O3 — CID 58982108
N-(2-aminophenyl)-8-[4-[4-(morpholin-4-ylmethyl)phenyl]phenyl]-8-oxooctanamide (PubChem CID 58982108) has the molecular formula C31H37N3O3 and a molecular weight of 499.66 g/mol. Its IUPAC name is N-(2-aminophenyl)-8-[4-[4-(morpholin-4-ylmethyl)phenyl]phenyl]-8-oxooctanamide.
| Compound Name | N-(2-aminophenyl)-8-[4-[4-(morpholin-4-ylmethyl)phenyl]phenyl]-8-oxooctanamide |
|---|---|
| PubChem CID | 58982108 |
| Molecular Formula | C31H37N3O3 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | N-(2-aminophenyl)-8-[4-[4-(morpholin-4-ylmethyl)phenyl]phenyl]-8-oxooctanamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCCC(=O)c1ccc(-c2ccc(CN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C31H37N3O3/c32-28-7-5-6-8-29(28)33-31(36)10-4-2-1-3-9-30(35)27-17-15-26(16-18-27)25-13-11-24(12-14-25)23-34-19-21-37-22-20-34/h5-8,11-18H,1-4,9-10,19-23,32H2,(H,33,36) |
| InChIKey | LLVQNMPWYNLSNJ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|