C20H23N3O2 — CID 70231522
(E)-N-(2-aminophenyl)-N'-(4-methylphenyl)hept-2-enediamide (PubChem CID 70231522) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is (E)-N-(2-aminophenyl)-N'-(4-methylphenyl)hept-2-enediamide.
| Compound Name | (E)-N-(2-aminophenyl)-N'-(4-methylphenyl)hept-2-enediamide |
|---|---|
| PubChem CID | 70231522 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | (E)-N-(2-aminophenyl)-N'-(4-methylphenyl)hept-2-enediamide |
| SMILES | Cc1ccc(NC(=O)CCC/C=C/C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C20H23N3O2/c1-15-11-13-16(14-12-15)22-19(24)9-3-2-4-10-20(25)23-18-8-6-5-7-17(18)21/h4-8,10-14H,2-3,9,21H2,1H3,(H,22,24)(H,23,25)/b10-4+ |
| InChIKey | UNWRTWVTUIFWPY-ONNFQVAWSA-N |
| XLogP | 3.88 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|