C27H30N2O3 — CID 58982124
N-(2-amino-4-methoxyphenyl)-8-oxo-8-(4-phenylphenyl)octanamide (PubChem CID 58982124) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is N-(2-amino-4-methoxyphenyl)-8-oxo-8-(4-phenylphenyl)octanamide.
| Compound Name | N-(2-amino-4-methoxyphenyl)-8-oxo-8-(4-phenylphenyl)octanamide |
|---|---|
| PubChem CID | 58982124 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | N-(2-amino-4-methoxyphenyl)-8-oxo-8-(4-phenylphenyl)octanamide |
| SMILES | COc1ccc(NC(=O)CCCCCCC(=O)c2ccc(-c3ccccc3)cc2)c(N)c1 |
| InChI | InChI=1S/C27H30N2O3/c1-32-23-17-18-25(24(28)19-23)29-27(31)12-8-3-2-7-11-26(30)22-15-13-21(14-16-22)20-9-5-4-6-10-20/h4-6,9-10,13-19H,2-3,7-8,11-12,28H2,1H3,(H,29,31) |
| InChIKey | WOXYZXXVUQKTEK-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|