C16H27N3O2 — CID 43272559
N-(2-amino-4-methoxyphenyl)-4-[butan-2-yl(methyl)amino]butanamide (PubChem CID 43272559) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is N-(2-amino-4-methoxyphenyl)-4-[butan-2-yl(methyl)amino]butanamide.
| Compound Name | N-(2-amino-4-methoxyphenyl)-4-[butan-2-yl(methyl)amino]butanamide |
|---|---|
| PubChem CID | 43272559 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | N-(2-amino-4-methoxyphenyl)-4-[butan-2-yl(methyl)amino]butanamide |
| SMILES | CCC(C)N(C)CCCC(=O)Nc1ccc(OC)cc1N |
| InChI | InChI=1S/C16H27N3O2/c1-5-12(2)19(3)10-6-7-16(20)18-15-9-8-13(21-4)11-14(15)17/h8-9,11-12H,5-7,10,17H2,1-4H3,(H,18,20) |
| InChIKey | KDSMQRNSABAHHH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|