C16H26FN3O — CID 43571694
N-(2-amino-4-fluorophenyl)-4-[methyl(pentan-2-yl)amino]butanamide (PubChem CID 43571694) has the molecular formula C16H26FN3O and a molecular weight of 295.40 g/mol. Its IUPAC name is N-(2-amino-4-fluorophenyl)-4-[methyl(pentan-2-yl)amino]butanamide.
| Compound Name | N-(2-amino-4-fluorophenyl)-4-[methyl(pentan-2-yl)amino]butanamide |
|---|---|
| PubChem CID | 43571694 |
| Molecular Formula | C16H26FN3O |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | N-(2-amino-4-fluorophenyl)-4-[methyl(pentan-2-yl)amino]butanamide |
| SMILES | CCCC(C)N(C)CCCC(=O)Nc1ccc(F)cc1N |
| InChI | InChI=1S/C16H26FN3O/c1-4-6-12(2)20(3)10-5-7-16(21)19-15-9-8-13(17)11-14(15)18/h8-9,11-12H,4-7,10,18H2,1-3H3,(H,19,21) |
| InChIKey | XTIIXQXGLIQYBA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|