C15H25N3O2S — CID 115985312
N-(2-amino-4-methoxyphenyl)-4-[methyl(2-methylsulfanylethyl)amino]butanamide (PubChem CID 115985312) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is N-(2-amino-4-methoxyphenyl)-4-[methyl(2-methylsulfanylethyl)amino]butanamide.
| Compound Name | N-(2-amino-4-methoxyphenyl)-4-[methyl(2-methylsulfanylethyl)amino]butanamide |
|---|---|
| PubChem CID | 115985312 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | N-(2-amino-4-methoxyphenyl)-4-[methyl(2-methylsulfanylethyl)amino]butanamide |
| SMILES | COc1ccc(NC(=O)CCCN(C)CCSC)c(N)c1 |
| InChI | InChI=1S/C15H25N3O2S/c1-18(9-10-21-3)8-4-5-15(19)17-14-7-6-12(20-2)11-13(14)16/h6-7,11H,4-5,8-10,16H2,1-3H3,(H,17,19) |
| InChIKey | FXJANXHKKXKLDA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|