C13H16N4O2S — CID 107779657
N-(2-amino-4-methoxyphenyl)-3-(1H-imidazol-2-ylsulfanyl)propanamide (PubChem CID 107779657) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is N-(2-amino-4-methoxyphenyl)-3-(1H-imidazol-2-ylsulfanyl)propanamide.
| Compound Name | N-(2-amino-4-methoxyphenyl)-3-(1H-imidazol-2-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 107779657 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | N-(2-amino-4-methoxyphenyl)-3-(1H-imidazol-2-ylsulfanyl)propanamide |
| SMILES | COc1ccc(NC(=O)CCSc2ncc[nH]2)c(N)c1 |
| InChI | InChI=1S/C13H16N4O2S/c1-19-9-2-3-11(10(14)8-9)17-12(18)4-7-20-13-15-5-6-16-13/h2-3,5-6,8H,4,7,14H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | JKDQFZCLYDUDCK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|