C16H18N2O3S — CID 23746050
N-(2,4-dimethoxyphenyl)-3-pyridin-2-ylsulfanylpropanamide (PubChem CID 23746050) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-3-pyridin-2-ylsulfanylpropanamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-3-pyridin-2-ylsulfanylpropanamide |
|---|---|
| PubChem CID | 23746050 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-3-pyridin-2-ylsulfanylpropanamide |
| SMILES | COc1ccc(NC(=O)CCSc2ccccn2)c(OC)c1 |
| InChI | InChI=1S/C16H18N2O3S/c1-20-12-6-7-13(14(11-12)21-2)18-15(19)8-10-22-16-5-3-4-9-17-16/h3-7,9,11H,8,10H2,1-2H3,(H,18,19) |
| InChIKey | BZFWXGJSMITHKK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |