C24H20N4O3S — CID 23861396
N-(2,4-dimethoxyphenyl)-3-(11,12,14-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-13-ylsulfanyl)propanamide (PubChem CID 23861396) has the molecular formula C24H20N4O3S and a molecular weight of 444.52 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-3-(11,12,14-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-13-ylsulfanyl)propanamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-3-(11,12,14-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-13-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 23861396 |
| Molecular Formula | C24H20N4O3S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-3-(11,12,14-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-13-ylsulfanyl)propanamide |
| SMILES | COc1ccc(NC(=O)CCSc2nnc3c(n2)-c2cccc4cccc-3c24)c(OC)c1 |
| InChI | InChI=1S/C24H20N4O3S/c1-30-15-9-10-18(19(13-15)31-2)25-20(29)11-12-32-24-26-22-16-7-3-5-14-6-4-8-17(21(14)16)23(22)27-28-24/h3-10,13H,11-12H2,1-2H3,(H,25,29) |
| InChIKey | CGKUJGDNFNESJS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |