C24H26N4O4S — CID 92868405
1-[(6S)-3-butylsulfanyl-6-(2,4-dimethoxyphenyl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone (PubChem CID 92868405) has the molecular formula C24H26N4O4S and a molecular weight of 466.56 g/mol. Its IUPAC name is 1-[(6S)-3-butylsulfanyl-6-(2,4-dimethoxyphenyl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone.
| Compound Name | 1-[(6S)-3-butylsulfanyl-6-(2,4-dimethoxyphenyl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
|---|---|
| PubChem CID | 92868405 |
| Molecular Formula | C24H26N4O4S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 1-[(6S)-3-butylsulfanyl-6-(2,4-dimethoxyphenyl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
| SMILES | CCCCSc1nnc2c(n1)O[C@@H](c1ccc(OC)cc1OC)N(C(C)=O)c1ccccc1-2 |
| InChI | InChI=1S/C24H26N4O4S/c1-5-6-13-33-24-25-22-21(26-27-24)17-9-7-8-10-19(17)28(15(2)29)23(32-22)18-12-11-16(30-3)14-20(18)31-4/h7-12,14,23H,5-6,13H2,1-4H3/t23-/m0/s1 |
| InChIKey | WIPQIERNCXIFGE-QHCPKHFHSA-N |
| XLogP | 4.89 |
| TPSA | 86.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|