C25H26N4O5S — CID 6406328
[2-[(6R)-7-acetyl-3-butylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-4-methoxyphenyl] acetate (PubChem CID 6406328) has the molecular formula C25H26N4O5S and a molecular weight of 494.57 g/mol. Its IUPAC name is [2-[(6R)-7-acetyl-3-butylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-4-methoxyphenyl] acetate.
| Compound Name | [2-[(6R)-7-acetyl-3-butylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-4-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 6406328 |
| Molecular Formula | C25H26N4O5S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | [2-[(6R)-7-acetyl-3-butylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-4-methoxyphenyl] acetate |
| SMILES | CCCCSc1nnc2c(n1)O[C@H](c1cc(OC)ccc1OC(C)=O)N(C(C)=O)c1ccccc1-2 |
| InChI | InChI=1S/C25H26N4O5S/c1-5-6-13-35-25-26-23-22(27-28-25)18-9-7-8-10-20(18)29(15(2)30)24(34-23)19-14-17(32-4)11-12-21(19)33-16(3)31/h7-12,14,24H,5-6,13H2,1-4H3/t24-/m1/s1 |
| InChIKey | KLCOXTCZXOKHFW-XMMPIXPASA-N |
| XLogP | 4.81 |
| TPSA | 103.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|