C24H25BrN4O3S — CID 6406383
1-[(6S)-6-(2-bromo-5-ethoxyphenyl)-3-butylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone (PubChem CID 6406383) has the molecular formula C24H25BrN4O3S and a molecular weight of 529.46 g/mol. Its IUPAC name is 1-[(6S)-6-(2-bromo-5-ethoxyphenyl)-3-butylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone.
| Compound Name | 1-[(6S)-6-(2-bromo-5-ethoxyphenyl)-3-butylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
|---|---|
| PubChem CID | 6406383 |
| Molecular Formula | C24H25BrN4O3S |
| Molecular Weight | 529.46 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | 1-[(6S)-6-(2-bromo-5-ethoxyphenyl)-3-butylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
| SMILES | CCCCSc1nnc2c(n1)O[C@@H](c1cc(OCC)ccc1Br)N(C(C)=O)c1ccccc1-2 |
| InChI | InChI=1S/C24H25BrN4O3S/c1-4-6-13-33-24-26-22-21(27-28-24)17-9-7-8-10-20(17)29(15(3)30)23(32-22)18-14-16(31-5-2)11-12-19(18)25/h7-12,14,23H,4-6,13H2,1-3H3/t23-/m0/s1 |
| InChIKey | NNNHTARWZUJBCM-QHCPKHFHSA-N |
| XLogP | 6.04 |
| TPSA | 77.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.46 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|