C25H25BrN4O4S — CID 6406585
1-[(6R)-6-(6-bromo-1,3-benzodioxol-5-yl)-3-hexylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone (PubChem CID 6406585) has the molecular formula C25H25BrN4O4S and a molecular weight of 557.47 g/mol. Its IUPAC name is 1-[(6R)-6-(6-bromo-1,3-benzodioxol-5-yl)-3-hexylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone.
| Compound Name | 1-[(6R)-6-(6-bromo-1,3-benzodioxol-5-yl)-3-hexylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
|---|---|
| PubChem CID | 6406585 |
| Molecular Formula | C25H25BrN4O4S |
| Molecular Weight | 557.47 g/mol |
| Exact Mass | 556.08 |
| IUPAC Name | 1-[(6R)-6-(6-bromo-1,3-benzodioxol-5-yl)-3-hexylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
| SMILES | CCCCCCSc1nnc2c(n1)O[C@H](c1cc3c(cc1Br)OCO3)N(C(C)=O)c1ccccc1-2 |
| InChI | InChI=1S/C25H25BrN4O4S/c1-3-4-5-8-11-35-25-27-23-22(28-29-25)16-9-6-7-10-19(16)30(15(2)31)24(34-23)17-12-20-21(13-18(17)26)33-14-32-20/h6-7,9-10,12-13,24H,3-5,8,11,14H2,1-2H3/t24-/m1/s1 |
| InChIKey | PILSGNZPZRGQLX-XMMPIXPASA-N |
| XLogP | 6.15 |
| TPSA | 86.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.47 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|