C26H29BrN4O4S — CID 6418400
1-[6-(5-bromo-2,3-dimethoxyphenyl)-3-hexylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone (PubChem CID 6418400) has the molecular formula C26H29BrN4O4S and a molecular weight of 573.51 g/mol. Its IUPAC name is 1-[6-(5-bromo-2,3-dimethoxyphenyl)-3-hexylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone.
| Compound Name | 1-[6-(5-bromo-2,3-dimethoxyphenyl)-3-hexylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
|---|---|
| PubChem CID | 6418400 |
| Molecular Formula | C26H29BrN4O4S |
| Molecular Weight | 573.51 g/mol |
| Exact Mass | 572.11 |
| IUPAC Name | 1-[6-(5-bromo-2,3-dimethoxyphenyl)-3-hexylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
| SMILES | CCCCCCSc1nnc2c(n1)OC(c1cc(Br)cc(OC)c1OC)N(C(C)=O)c1ccccc1-2 |
| InChI | InChI=1S/C26H29BrN4O4S/c1-5-6-7-10-13-36-26-28-24-22(29-30-26)18-11-8-9-12-20(18)31(16(2)32)25(35-24)19-14-17(27)15-21(33-3)23(19)34-4/h8-9,11-12,14-15,25H,5-7,10,13H2,1-4H3 |
| InChIKey | UFLXRWIEOOSESJ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 86.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.51 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|