C27H32N4O4S — CID 6406608
1-[(6S)-6-(3-ethoxy-2-methoxyphenyl)-3-hexylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone (PubChem CID 6406608) has the molecular formula C27H32N4O4S and a molecular weight of 508.64 g/mol. Its IUPAC name is 1-[(6S)-6-(3-ethoxy-2-methoxyphenyl)-3-hexylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone.
| Compound Name | 1-[(6S)-6-(3-ethoxy-2-methoxyphenyl)-3-hexylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
|---|---|
| PubChem CID | 6406608 |
| Molecular Formula | C27H32N4O4S |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 1-[(6S)-6-(3-ethoxy-2-methoxyphenyl)-3-hexylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
| SMILES | CCCCCCSc1nnc2c(n1)O[C@@H](c1cccc(OCC)c1OC)N(C(C)=O)c1ccccc1-2 |
| InChI | InChI=1S/C27H32N4O4S/c1-5-7-8-11-17-36-27-28-25-23(29-30-27)19-13-9-10-15-21(19)31(18(3)32)26(35-25)20-14-12-16-22(34-6-2)24(20)33-4/h9-10,12-16,26H,5-8,11,17H2,1-4H3/t26-/m0/s1 |
| InChIKey | IMAAWHYBGRBEBM-SANMLTNESA-N |
| XLogP | 6.06 |
| TPSA | 86.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|