C29H30N4O3S — CID 6406463
1-[(6R)-6-(2-ethoxynaphthalen-1-yl)-3-pentylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone (PubChem CID 6406463) has the molecular formula C29H30N4O3S and a molecular weight of 514.65 g/mol. Its IUPAC name is 1-[(6R)-6-(2-ethoxynaphthalen-1-yl)-3-pentylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone.
| Compound Name | 1-[(6R)-6-(2-ethoxynaphthalen-1-yl)-3-pentylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
|---|---|
| PubChem CID | 6406463 |
| Molecular Formula | C29H30N4O3S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 1-[(6R)-6-(2-ethoxynaphthalen-1-yl)-3-pentylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
| SMILES | CCCCCSc1nnc2c(n1)O[C@H](c1c(OCC)ccc3ccccc13)N(C(C)=O)c1ccccc1-2 |
| InChI | InChI=1S/C29H30N4O3S/c1-4-6-11-18-37-29-30-27-26(31-32-29)22-14-9-10-15-23(22)33(19(3)34)28(36-27)25-21-13-8-7-12-20(21)16-17-24(25)35-5-2/h7-10,12-17,28H,4-6,11,18H2,1-3H3/t28-/m1/s1 |
| InChIKey | FPZBQAQTKMGGGB-MUUNZHRXSA-N |
| XLogP | 6.82 |
| TPSA | 77.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|