C21H22N4O2S2 — CID 22332134
1-(3-pentylsulfanyl-6-thiophen-3-yl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl)ethanone (PubChem CID 22332134) has the molecular formula C21H22N4O2S2 and a molecular weight of 426.57 g/mol. Its IUPAC name is 1-(3-pentylsulfanyl-6-thiophen-3-yl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl)ethanone.
| Compound Name | 1-(3-pentylsulfanyl-6-thiophen-3-yl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl)ethanone |
|---|---|
| PubChem CID | 22332134 |
| Molecular Formula | C21H22N4O2S2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 1-(3-pentylsulfanyl-6-thiophen-3-yl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl)ethanone |
| SMILES | CCCCCSc1nnc2c(n1)OC(c1ccsc1)N(C(C)=O)c1ccccc1-2 |
| InChI | InChI=1S/C21H22N4O2S2/c1-3-4-7-11-29-21-22-19-18(23-24-21)16-8-5-6-9-17(16)25(14(2)26)20(27-19)15-10-12-28-13-15/h5-6,8-10,12-13,20H,3-4,7,11H2,1-2H3 |
| InChIKey | SEYYJMFISSFYCA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|